C20H27N3O4S — CID 86901842
4-ethoxy-3-pyrrolidin-1-ylsulfonyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)aniline (PubChem CID 86901842) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-ethoxy-3-pyrrolidin-1-ylsulfonyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)aniline.
| Compound Name | 4-ethoxy-3-pyrrolidin-1-ylsulfonyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 86901842 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-ethoxy-3-pyrrolidin-1-ylsulfonyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)aniline |
| SMILES | CCOc1ccc(NCc2noc3c2CCCC3)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H27N3O4S/c1-2-26-19-10-9-15(13-20(19)28(24,25)23-11-5-6-12-23)21-14-17-16-7-3-4-8-18(16)27-22-17/h9-10,13,21H,2-8,11-12,14H2,1H3 |
| InChIKey | AQPJKYWRXJOHJY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|