C17H16N2O4S — CID 7625039
imidazo[1,2-a]pyridin-2-ylmethyl 4-(methylsulfonylmethyl)benzoate (PubChem CID 7625039) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl 4-(methylsulfonylmethyl)benzoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 7625039 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl 4-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)OCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-24(21,22)12-13-5-7-14(8-6-13)17(20)23-11-15-10-19-9-3-2-4-16(19)18-15/h2-10H,11-12H2,1H3 |
| InChIKey | NFDQREVZZXHJBY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |