C20H18ClNO2S2 — CID 34732993
N-[2-(4-chlorophenoxy)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 34732993) has the molecular formula C20H18ClNO2S2 and a molecular weight of 403.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 34732993 |
| Molecular Formula | C20H18ClNO2S2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C20H18ClNO2S2/c21-15-7-9-16(10-8-15)24-12-11-22-20(23)18-5-1-2-6-19(18)26-14-17-4-3-13-25-17/h1-10,13H,11-12,14H2,(H,22,23) |
| InChIKey | IXKBOSNPYSMUJU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|