C23H18ClNO2S2 — CID 18227464
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 18227464) has the molecular formula C23H18ClNO2S2 and a molecular weight of 439.99 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 18227464 |
| Molecular Formula | C23H18ClNO2S2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(NCc1ccc(-c2ccc(Cl)cc2)o1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C23H18ClNO2S2/c24-17-9-7-16(8-10-17)21-12-11-18(27-21)14-25-23(26)20-5-1-2-6-22(20)29-15-19-4-3-13-28-19/h1-13H,14-15H2,(H,25,26) |
| InChIKey | NDPQIYWPDCBQNS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |