C19H16ClNO2 — CID 166341635
4-chloro-2-methyl-N-[(5-phenylfuran-2-yl)methyl]benzamide (PubChem CID 166341635) has the molecular formula C19H16ClNO2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-[(5-phenylfuran-2-yl)methyl]benzamide.
| Compound Name | 4-chloro-2-methyl-N-[(5-phenylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 166341635 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 4-chloro-2-methyl-N-[(5-phenylfuran-2-yl)methyl]benzamide |
| SMILES | Cc1cc(Cl)ccc1C(=O)NCc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H16ClNO2/c1-13-11-15(20)7-9-17(13)19(22)21-12-16-8-10-18(23-16)14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | LFYUVEVQWKRQHM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |