C21H19ClN2O3 — CID 9120196
N-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 9120196) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is N-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 9120196 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | O=C(CNC(=O)Cc1ccccc1)NCc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H19ClN2O3/c22-17-8-6-16(7-9-17)19-11-10-18(27-19)13-23-21(26)14-24-20(25)12-15-4-2-1-3-5-15/h1-11H,12-14H2,(H,23,26)(H,24,25) |
| InChIKey | RFYIXHANLHWXGV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |