C22H22ClN3O4 — CID 55565805
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[3-[(2-methoxyacetyl)amino]anilino]acetamide (PubChem CID 55565805) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[3-[(2-methoxyacetyl)amino]anilino]acetamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[3-[(2-methoxyacetyl)amino]anilino]acetamide |
|---|---|
| PubChem CID | 55565805 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[3-[(2-methoxyacetyl)amino]anilino]acetamide |
| SMILES | COCC(=O)Nc1cccc(NCC(=O)NCc2ccc(-c3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C22H22ClN3O4/c1-29-14-22(28)26-18-4-2-3-17(11-18)24-13-21(27)25-12-19-9-10-20(30-19)15-5-7-16(23)8-6-15/h2-11,24H,12-14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | INQOMVUNGOLLQI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |