C22H18ClNO4 — CID 31515588
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 31515588) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 31515588 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(methoxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | COCc1c(C(=O)NCc2ccc(-c3ccc(Cl)cc3)o2)oc2ccccc12 |
| InChI | InChI=1S/C22H18ClNO4/c1-26-13-18-17-4-2-3-5-20(17)28-21(18)22(25)24-12-16-10-11-19(27-16)14-6-8-15(23)9-7-14/h2-11H,12-13H2,1H3,(H,24,25) |
| InChIKey | IWWLITGYEPZLIQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |