C20H25ClFN3O2 — CID 119548063
N-[1-[2-(4-aminophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide;hydrochloride (PubChem CID 119548063) has the molecular formula C20H25ClFN3O2 and a molecular weight of 393.89 g/mol. Its IUPAC name is N-[1-[2-(4-aminophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide;hydrochloride.
| Compound Name | N-[1-[2-(4-aminophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119548063 |
| Molecular Formula | C20H25ClFN3O2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[1-[2-(4-aminophenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide;hydrochloride |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NCCc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C20H24FN3O2.ClH/c1-13(2)18(24-19(25)16-5-3-4-6-17(16)21)20(26)23-12-11-14-7-9-15(22)10-8-14;/h3-10,13,18H,11-12,22H2,1-2H3,(H,23,26)(H,24,25);1H |
| InChIKey | BDUJDTLFGKEXEF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|