C18H39N3O3S — CID 170709349
ethane;1-methylsulfonyl-N-[6-(propan-2-ylamino)hexyl]piperidine-4-carboxamide (PubChem CID 170709349) has the molecular formula C18H39N3O3S and a molecular weight of 377.60 g/mol. Its IUPAC name is ethane;1-methylsulfonyl-N-[6-(propan-2-ylamino)hexyl]piperidine-4-carboxamide.
| Compound Name | ethane;1-methylsulfonyl-N-[6-(propan-2-ylamino)hexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 170709349 |
| Molecular Formula | C18H39N3O3S |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | ethane;1-methylsulfonyl-N-[6-(propan-2-ylamino)hexyl]piperidine-4-carboxamide |
| SMILES | CC.CC(C)NCCCCCCNC(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H33N3O3S.C2H6/c1-14(2)17-10-6-4-5-7-11-18-16(20)15-8-12-19(13-9-15)23(3,21)22;1-2/h14-15,17H,4-13H2,1-3H3,(H,18,20);1-2H3 |
| InChIKey | SZHBXOXXOISWQA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|