C17H31N5O3S — CID 170709380
N-[6-(5-ethyltriazol-1-yl)hexyl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 170709380) has the molecular formula C17H31N5O3S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-[6-(5-ethyltriazol-1-yl)hexyl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[6-(5-ethyltriazol-1-yl)hexyl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 170709380 |
| Molecular Formula | C17H31N5O3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N-[6-(5-ethyltriazol-1-yl)hexyl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CCc1cnnn1CCCCCCNC(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H31N5O3S/c1-3-16-14-19-20-22(16)11-7-5-4-6-10-18-17(23)15-8-12-21(13-9-15)26(2,24)25/h14-15H,3-13H2,1-2H3,(H,18,23) |
| InChIKey | YQXPGVUEIDINJS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|