C17H21BrN4O3S — CID 19282977
1-(benzenesulfonyl)-N-[2-(4-bromopyrazol-1-yl)ethyl]piperidine-4-carboxamide (PubChem CID 19282977) has the molecular formula C17H21BrN4O3S and a molecular weight of 441.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(4-bromopyrazol-1-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(4-bromopyrazol-1-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 19282977 |
| Molecular Formula | C17H21BrN4O3S |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(4-bromopyrazol-1-yl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCn1cc(Br)cn1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H21BrN4O3S/c18-15-12-20-21(13-15)11-8-19-17(23)14-6-9-22(10-7-14)26(24,25)16-4-2-1-3-5-16/h1-5,12-14H,6-11H2,(H,19,23) |
| InChIKey | KYUCZCLJGBMESG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |