C16H23N7O — CID 97076085
(3R)-3-(4-methyl-1,2,4-triazol-3-yl)-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1-carboxamide (PubChem CID 97076085) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is (3R)-3-(4-methyl-1,2,4-triazol-3-yl)-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(4-methyl-1,2,4-triazol-3-yl)-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97076085 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (3R)-3-(4-methyl-1,2,4-triazol-3-yl)-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1-carboxamide |
| SMILES | Cn1cnnc1[C@@H]1CCCN(C(=O)NCCNc2ccccn2)C1 |
| InChI | InChI=1S/C16H23N7O/c1-22-12-20-21-15(22)13-5-4-10-23(11-13)16(24)19-9-8-18-14-6-2-3-7-17-14/h2-3,6-7,12-13H,4-5,8-11H2,1H3,(H,17,18)(H,19,24)/t13-/m1/s1 |
| InChIKey | QIYOLXSEDLTHBQ-CYBMUJFWSA-N |
| XLogP | 1.21 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|