C22H28N4O3 — CID 69178381
methyl 2-[2-[3-(pyridin-2-ylamino)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate (PubChem CID 69178381) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 2-[2-[3-(pyridin-2-ylamino)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate.
| Compound Name | methyl 2-[2-[3-(pyridin-2-ylamino)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate |
|---|---|
| PubChem CID | 69178381 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | methyl 2-[2-[3-(pyridin-2-ylamino)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate |
| SMILES | COC(=O)CC1CCN(C(=O)NCCCNc2ccccn2)Cc2ccccc21 |
| InChI | InChI=1S/C22H28N4O3/c1-29-21(27)15-17-10-14-26(16-18-7-2-3-8-19(17)18)22(28)25-13-6-12-24-20-9-4-5-11-23-20/h2-5,7-9,11,17H,6,10,12-16H2,1H3,(H,23,24)(H,25,28) |
| InChIKey | GPRZNUZCPWJQGO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|