C25H33N3O3 — CID 18671419
methyl 2-[3-[7-(pyridin-2-ylamino)heptanoyl]-1,2,4,5-tetrahydro-3-benzazepin-5-yl]acetate (PubChem CID 18671419) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is methyl 2-[3-[7-(pyridin-2-ylamino)heptanoyl]-1,2,4,5-tetrahydro-3-benzazepin-5-yl]acetate.
| Compound Name | methyl 2-[3-[7-(pyridin-2-ylamino)heptanoyl]-1,2,4,5-tetrahydro-3-benzazepin-5-yl]acetate |
|---|---|
| PubChem CID | 18671419 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | methyl 2-[3-[7-(pyridin-2-ylamino)heptanoyl]-1,2,4,5-tetrahydro-3-benzazepin-5-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)CCCCCCNc2ccccn2)CCc2ccccc21 |
| InChI | InChI=1S/C25H33N3O3/c1-31-25(30)18-21-19-28(17-14-20-10-5-6-11-22(20)21)24(29)13-4-2-3-8-15-26-23-12-7-9-16-27-23/h5-7,9-12,16,21H,2-4,8,13-15,17-19H2,1H3,(H,26,27) |
| InChIKey | WHXSVFWZIQSHQL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|