C24H34N7O+ — CID 142054826
(Z)-amino-[1-amino-2-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethylidene]azanium (PubChem CID 142054826) has the molecular formula C24H34N7O+ and a molecular weight of 436.58 g/mol. Its IUPAC name is (Z)-amino-[1-amino-2-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethylidene]azanium.
| Compound Name | (Z)-amino-[1-amino-2-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethylidene]azanium |
|---|---|
| PubChem CID | 142054826 |
| Molecular Formula | C24H34N7O+ |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (Z)-amino-[1-amino-2-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethylidene]azanium |
| SMILES | N/[NH+]=C(\N)CC1CCN(C(=O)NCCCc2ccc3c(n2)NCCC3)Cc2ccccc21 |
| InChI | InChI=1S/C24H33N7O/c25-22(30-26)15-18-11-14-31(16-19-5-1-2-8-21(18)19)24(32)28-13-4-7-20-10-9-17-6-3-12-27-23(17)29-20/h1-2,5,8-10,18H,3-4,6-7,11-16,26H2,(H2,25,30)(H,27,29)(H,28,32)/p+1 |
| InChIKey | BYGFHBCJTJLFOF-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|