C16H30N4O4 — CID 56826198
tert-butyl N-[2-[(4-carbamoylpiperidine-1-carbonyl)amino]ethyl]-N-ethylcarbamate (PubChem CID 56826198) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-carbamoylpiperidine-1-carbonyl)amino]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[(4-carbamoylpiperidine-1-carbonyl)amino]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 56826198 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl N-[2-[(4-carbamoylpiperidine-1-carbonyl)amino]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCNC(=O)N1CCC(C(N)=O)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N4O4/c1-5-19(15(23)24-16(2,3)4)11-8-18-14(22)20-9-6-12(7-10-20)13(17)21/h12H,5-11H2,1-4H3,(H2,17,21)(H,18,22) |
| InChIKey | SJEQGKYGJBQYGE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |