C20H37IN4O4 — CID 111156890
ethyl 1-[N-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156890) has the molecular formula C20H37IN4O4 and a molecular weight of 524.44 g/mol. Its IUPAC name is ethyl 1-[N-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156890 |
| Molecular Formula | C20H37IN4O4 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | ethyl 1-[N-[2-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCN(C(=O)OC(C)(C)C)C2CC2)CC1.I |
| InChI | InChI=1S/C20H36N4O4.HI/c1-6-27-17(25)15-9-12-23(13-10-15)18(21-5)22-11-14-24(16-7-8-16)19(26)28-20(2,3)4;/h15-16H,6-14H2,1-5H3,(H,21,22);1H |
| InChIKey | PTDWAICVPTWXPL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|