C18H34N4O2 — CID 111738344
tert-butyl N-cyclopropyl-N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]carbamate (PubChem CID 111738344) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111738344 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCN(C(=O)OC(C)(C)C)C1CC1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C18H34N4O2/c1-17(2,3)24-16(23)22(14-7-8-14)12-10-20-15(19-6)21-11-9-18(4,5)13-21/h14H,7-13H2,1-6H3,(H,19,20) |
| InChIKey | WWYWNRPWPYQWDP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|