C21H33N5O4 — CID 111168065
tert-butyl N-cyclopropyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate (PubChem CID 111168065) has the molecular formula C21H33N5O4 and a molecular weight of 419.53 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111168065 |
| Molecular Formula | C21H33N5O4 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCN(C(=O)OC(C)(C)C)C1CC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H33N5O4/c1-21(2,3)30-20(28)26(16-7-8-16)10-9-23-19(22-4)25-13-11-24(12-14-25)18(27)17-6-5-15-29-17/h5-6,15-16H,7-14H2,1-4H3,(H,22,23) |
| InChIKey | QKRGOUOWNDGZJX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|