C16H31N3O3 — CID 51135947
tert-butyl N-[2-(cyclopentylmethylcarbamoylamino)ethyl]-N-ethylcarbamate (PubChem CID 51135947) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl N-[2-(cyclopentylmethylcarbamoylamino)ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-(cyclopentylmethylcarbamoylamino)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 51135947 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | tert-butyl N-[2-(cyclopentylmethylcarbamoylamino)ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCNC(=O)NCC1CCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N3O3/c1-5-19(15(21)22-16(2,3)4)11-10-17-14(20)18-12-13-8-6-7-9-13/h13H,5-12H2,1-4H3,(H2,17,18,20) |
| InChIKey | ULIZTHOOTCRJET-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |