C19H38N2O2 — CID 107245484
tert-butyl N-ethyl-N-[2-[(4-propylcycloheptyl)amino]ethyl]carbamate (PubChem CID 107245484) has the molecular formula C19H38N2O2 and a molecular weight of 326.52 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-[(4-propylcycloheptyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-[(4-propylcycloheptyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107245484 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-[(4-propylcycloheptyl)amino]ethyl]carbamate |
| SMILES | CCCC1CCCC(NCCN(CC)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H38N2O2/c1-6-9-16-10-8-11-17(13-12-16)20-14-15-21(7-2)18(22)23-19(3,4)5/h16-17,20H,6-15H2,1-5H3 |
| InChIKey | PETOIXLVBCOISX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |