C19H38N2O2 — CID 107242640
tert-butyl N-[3-[(4,4-dimethylcycloheptyl)amino]propyl]-N-ethylcarbamate (PubChem CID 107242640) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is tert-butyl N-[3-[(4,4-dimethylcycloheptyl)amino]propyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[3-[(4,4-dimethylcycloheptyl)amino]propyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 107242640 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | tert-butyl N-[3-[(4,4-dimethylcycloheptyl)amino]propyl]-N-ethylcarbamate |
| SMILES | CCN(CCCNC1CCCC(C)(C)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-7-21(17(22)23-18(2,3)4)15-9-14-20-16-10-8-12-19(5,6)13-11-16/h16,20H,7-15H2,1-6H3 |
| InChIKey | DBTYEDCECUTKMJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|