C17H27ClN2O2S — CID 107242675
tert-butyl N-[3-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]propyl]-N-ethylcarbamate (PubChem CID 107242675) has the molecular formula C17H27ClN2O2S and a molecular weight of 358.94 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]propyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[3-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]propyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 107242675 |
| Molecular Formula | C17H27ClN2O2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl N-[3-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]propyl]-N-ethylcarbamate |
| SMILES | CCN(CCCNC1CCc2sc(Cl)cc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27ClN2O2S/c1-5-20(16(21)22-17(2,3)4)10-6-9-19-13-7-8-14-12(13)11-15(18)23-14/h11,13,19H,5-10H2,1-4H3 |
| InChIKey | HAULTYJWMICRCU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|