C11H16ClNS2 — CID 81251743
2-chloro-N-(3-methylsulfanylpropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 81251743) has the molecular formula C11H16ClNS2 and a molecular weight of 261.84 g/mol. Its IUPAC name is 2-chloro-N-(3-methylsulfanylpropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
| Compound Name | 2-chloro-N-(3-methylsulfanylpropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
|---|---|
| PubChem CID | 81251743 |
| Molecular Formula | C11H16ClNS2 |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-chloro-N-(3-methylsulfanylpropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | CSCCCNC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C11H16ClNS2/c1-14-6-2-5-13-9-3-4-10-8(9)7-11(12)15-10/h7,9,13H,2-6H2,1H3 |
| InChIKey | MIJXXPLEZUGZTD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|