C12H16ClNO2S — CID 81252064
methyl 4-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]butanoate (PubChem CID 81252064) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is methyl 4-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]butanoate.
| Compound Name | methyl 4-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 81252064 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl 4-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]butanoate |
| SMILES | COC(=O)CCCNC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClNO2S/c1-16-12(15)3-2-6-14-9-4-5-10-8(9)7-11(13)17-10/h7,9,14H,2-6H2,1H3 |
| InChIKey | RVAMXKWDOFQGBQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|