C10H20N4O — CID 82508516
N-(2-aminoethyl)-4-cyclopropylpiperazine-1-carboxamide (PubChem CID 82508516) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-cyclopropylpiperazine-1-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-cyclopropylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 82508516 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N-(2-aminoethyl)-4-cyclopropylpiperazine-1-carboxamide |
| SMILES | NCCNC(=O)N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C10H20N4O/c11-3-4-12-10(15)14-7-5-13(6-8-14)9-1-2-9/h9H,1-8,11H2,(H,12,15) |
| InChIKey | JLZCGDQSPIDRBZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |