C22H35N3O5S — CID 144951064
(2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentoxy]methylamino]-3-phenylpropanoic acid (PubChem CID 144951064) has the molecular formula C22H35N3O5S and a molecular weight of 453.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentoxy]methylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentoxy]methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 144951064 |
| Molecular Formula | C22H35N3O5S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentoxy]methylamino]-3-phenylpropanoic acid |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@H](COCN[C@@H](Cc1ccccc1)C(=O)O)CC(C)C |
| InChI | InChI=1S/C22H35N3O5S/c1-16(2)11-18(25-21(27)19(23-14-26)9-10-31-3)13-30-15-24-20(22(28)29)12-17-7-5-4-6-8-17/h4-8,14,16,18-20,24H,9-13,15H2,1-3H3,(H,23,26)(H,25,27)(H,28,29)/t18-,19-,20-/m0/s1 |
| InChIKey | HLQNACGRBRFVIH-UFYCRDLUSA-N |
| XLogP | 1.64 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|