C26H36N6O4S — CID 18395610
N-[5-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentyl]pyrazine-2-carboxamide (PubChem CID 18395610) has the molecular formula C26H36N6O4S and a molecular weight of 528.68 g/mol. Its IUPAC name is N-[5-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentyl]pyrazine-2-carboxamide.
| Compound Name | N-[5-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 18395610 |
| Molecular Formula | C26H36N6O4S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-[5-[[(2S)-4-methyl-1-[[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentyl]pyrazine-2-carboxamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)C(S)CCCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C26H36N6O4S/c1-17(2)14-19(25(35)31-20(23(33)27-3)15-18-8-5-4-6-9-18)32-26(36)22(37)10-7-11-30-24(34)21-16-28-12-13-29-21/h4-6,8-9,12-13,16-17,19-20,22,37H,7,10-11,14-15H2,1-3H3,(H,27,33)(H,30,34)(H,31,35)(H,32,36)/t19-,20-,22?/m0/s1 |
| InChIKey | GWTDTYCOVJLDAQ-ZDOMSUIMSA-N |
| XLogP | 1.29 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|