C27H37N5O6S — CID 54536533
S-[1-[[(2S)-1-[(4-acetylpiperazin-1-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl] ethanethioate (PubChem CID 54536533) has the molecular formula C27H37N5O6S and a molecular weight of 559.69 g/mol. Its IUPAC name is S-[1-[[(2S)-1-[(4-acetylpiperazin-1-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl] ethanethioate.
| Compound Name | S-[1-[[(2S)-1-[(4-acetylpiperazin-1-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 54536533 |
| Molecular Formula | C27H37N5O6S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | S-[1-[[(2S)-1-[(4-acetylpiperazin-1-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl] ethanethioate |
| SMILES | CC(=O)SC(CCCN1C(=O)c2ccccc2C1=O)C(=O)N[C@@H](CC(C)C)C(=O)NN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C27H37N5O6S/c1-17(2)16-22(24(35)29-31-14-12-30(13-15-31)18(3)33)28-25(36)23(39-19(4)34)10-7-11-32-26(37)20-8-5-6-9-21(20)27(32)38/h5-6,8-9,17,22-23H,7,10-16H2,1-4H3,(H,28,36)(H,29,35)/t22-,23?/m0/s1 |
| InChIKey | ZAEFLGAYAPPMOT-NQCNTLBGSA-N |
| XLogP | 1.44 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|