C30H36N4O5S — CID 54162603
(2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-4-methylpentanamide (PubChem CID 54162603) has the molecular formula C30H36N4O5S and a molecular weight of 564.71 g/mol. Its IUPAC name is (2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 54162603 |
| Molecular Formula | C30H36N4O5S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | (2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-4-methylpentanamide |
| SMILES | COc1ccc2c(CCNC(=O)[C@H](CC(C)C)NC(=O)C(S)CCCN3C(=O)c4ccccc4C3=O)c[nH]c2c1 |
| InChI | InChI=1S/C30H36N4O5S/c1-18(2)15-25(27(35)31-13-12-19-17-32-24-16-20(39-3)10-11-21(19)24)33-28(36)26(40)9-6-14-34-29(37)22-7-4-5-8-23(22)30(34)38/h4-5,7-8,10-11,16-18,25-26,32,40H,6,9,12-15H2,1-3H3,(H,31,35)(H,33,36)/t25-,26?/m0/s1 |
| InChIKey | OPMAFIGXRSGGEY-PMCHYTPCSA-N |
| XLogP | 3.74 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|