C31H37N5O5S — CID 57098856
N-[(2S)-3-[1-[(2S)-2-amino-4-methylpentanoyl]indol-3-yl]-1-(methylamino)-1-oxopropan-2-yl]-5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanamide (PubChem CID 57098856) has the molecular formula C31H37N5O5S and a molecular weight of 591.73 g/mol. Its IUPAC name is N-[(2S)-3-[1-[(2S)-2-amino-4-methylpentanoyl]indol-3-yl]-1-(methylamino)-1-oxopropan-2-yl]-5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanamide.
| Compound Name | N-[(2S)-3-[1-[(2S)-2-amino-4-methylpentanoyl]indol-3-yl]-1-(methylamino)-1-oxopropan-2-yl]-5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanamide |
|---|---|
| PubChem CID | 57098856 |
| Molecular Formula | C31H37N5O5S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | N-[(2S)-3-[1-[(2S)-2-amino-4-methylpentanoyl]indol-3-yl]-1-(methylamino)-1-oxopropan-2-yl]-5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanamide |
| SMILES | CNC(=O)[C@H](Cc1cn(C(=O)[C@@H](N)CC(C)C)c2ccccc12)NC(=O)C(S)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H37N5O5S/c1-18(2)15-23(32)31(41)36-17-19(20-9-6-7-12-25(20)36)16-24(27(37)33-3)34-28(38)26(42)13-8-14-35-29(39)21-10-4-5-11-22(21)30(35)40/h4-7,9-12,17-18,23-24,26,42H,8,13-16,32H2,1-3H3,(H,33,37)(H,34,38)/t23-,24-,26?/m0/s1 |
| InChIKey | LKBPSVJOHAHFIF-OKHNBNEASA-N |
| XLogP | 2.80 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|