C28H36N8O3 — CID 71660941
(2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]pentanamide (PubChem CID 71660941) has the molecular formula C28H36N8O3 and a molecular weight of 532.65 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 71660941 |
| Molecular Formula | C28H36N8O3 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]pentanamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@@H](N)CCCN=C(N)N)c2c1 |
| InChI | InChI=1S/C28H36N8O3/c1-39-19-8-9-24-21(14-19)17(15-34-24)10-12-32-27(38)25(13-18-16-35-23-7-3-2-5-20(18)23)36-26(37)22(29)6-4-11-33-28(30)31/h2-3,5,7-9,14-16,22,25,34-35H,4,6,10-13,29H2,1H3,(H,32,38)(H,36,37)(H4,30,31,33)/t22-,25-/m0/s1 |
| InChIKey | XJHZHJSSCMQNHJ-DHLKQENFSA-N |
| XLogP | 1.42 |
| TPSA | 189.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|