C24H36N8O5S — CID 175713779
(2R)-2-[4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid (PubChem CID 175713779) has the molecular formula C24H36N8O5S and a molecular weight of 548.67 g/mol. Its IUPAC name is (2R)-2-[4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175713779 |
| Molecular Formula | C24H36N8O5S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (2R)-2-[4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCCC(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C24H36N8O5S/c25-16(6-3-10-29-24(26)27)21(34)32-18(11-14-12-30-17-7-2-1-5-15(14)17)22(35)28-9-4-8-20(33)31-19(13-38)23(36)37/h1-2,5,7,12,16,18-19,30,38H,3-4,6,8-11,13,25H2,(H,28,35)(H,31,33)(H,32,34)(H,36,37)(H4,26,27,29)/t16-,18-,19-/m0/s1 |
| InChIKey | AKMAASKRLCFBDL-WDSOQIARSA-N |
| XLogP | -1.03 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|