C32H41IN4O5 — CID 59841710
(2R)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-[3-[(4-iodophenyl)methylamino]-3-oxopropoxy]ethylamino]-1-oxopropan-2-yl]-2-(2-methylpropyl)-4-oxopentanamide (PubChem CID 59841710) has the molecular formula C32H41IN4O5 and a molecular weight of 688.61 g/mol. Its IUPAC name is (2R)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-[3-[(4-iodophenyl)methylamino]-3-oxopropoxy]ethylamino]-1-oxopropan-2-yl]-2-(2-methylpropyl)-4-oxopentanamide.
| Compound Name | (2R)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-[3-[(4-iodophenyl)methylamino]-3-oxopropoxy]ethylamino]-1-oxopropan-2-yl]-2-(2-methylpropyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 59841710 |
| Molecular Formula | C32H41IN4O5 |
| Molecular Weight | 688.61 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | (2R)-N-[(2S)-3-(1H-indol-3-yl)-1-[2-[3-[(4-iodophenyl)methylamino]-3-oxopropoxy]ethylamino]-1-oxopropan-2-yl]-2-(2-methylpropyl)-4-oxopentanamide |
| SMILES | CC(=O)C[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCOCCC(=O)NCc1ccc(I)cc1 |
| InChI | InChI=1S/C32H41IN4O5/c1-21(2)16-24(17-22(3)38)31(40)37-29(18-25-20-35-28-7-5-4-6-27(25)28)32(41)34-13-15-42-14-12-30(39)36-19-23-8-10-26(33)11-9-23/h4-11,20-21,24,29,35H,12-19H2,1-3H3,(H,34,41)(H,36,39)(H,37,40)/t24-,29+/m1/s1 |
| InChIKey | HOAWOMHHKKWADF-GIGWZHCTSA-N |
| XLogP | 4.28 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|