C24H36N4O3 — CID 160832048
(2R)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-(1H-indol-3-yl)-4-methyl-3-oxopentan-2-yl]-4-methylpentanamide (PubChem CID 160832048) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is (2R)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-(1H-indol-3-yl)-4-methyl-3-oxopentan-2-yl]-4-methylpentanamide.
| Compound Name | (2R)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-(1H-indol-3-yl)-4-methyl-3-oxopentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 160832048 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (2R)-2-[3-(carbamoylamino)propyl]-N-[(2S)-1-(1H-indol-3-yl)-4-methyl-3-oxopentan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](CCCNC(N)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)C(C)C |
| InChI | InChI=1S/C24H36N4O3/c1-15(2)12-17(8-7-11-26-24(25)31)23(30)28-21(22(29)16(3)4)13-18-14-27-20-10-6-5-9-19(18)20/h5-6,9-10,14-17,21,27H,7-8,11-13H2,1-4H3,(H,28,30)(H3,25,26,31)/t17-,21+/m1/s1 |
| InChIKey | SGXPZVPRSLGYTP-UTKZUKDTSA-N |
| XLogP | 3.53 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|