C21H31N5O3S — CID 146533423
S-methyl (2S)-5-(carbamoylamino)-2-[[(2R)-3-(1H-indol-3-yl)-2-(propan-2-ylamino)propanoyl]amino]pentanethioate (PubChem CID 146533423) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is S-methyl (2S)-5-(carbamoylamino)-2-[[(2R)-3-(1H-indol-3-yl)-2-(propan-2-ylamino)propanoyl]amino]pentanethioate.
| Compound Name | S-methyl (2S)-5-(carbamoylamino)-2-[[(2R)-3-(1H-indol-3-yl)-2-(propan-2-ylamino)propanoyl]amino]pentanethioate |
|---|---|
| PubChem CID | 146533423 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | S-methyl (2S)-5-(carbamoylamino)-2-[[(2R)-3-(1H-indol-3-yl)-2-(propan-2-ylamino)propanoyl]amino]pentanethioate |
| SMILES | CSC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(C)C |
| InChI | InChI=1S/C21H31N5O3S/c1-13(2)25-18(11-14-12-24-16-8-5-4-7-15(14)16)19(27)26-17(20(28)30-3)9-6-10-23-21(22)29/h4-5,7-8,12-13,17-18,24-25H,6,9-11H2,1-3H3,(H,26,27)(H3,22,23,29)/t17-,18+/m0/s1 |
| InChIKey | DDUPXGVFAUDVOH-ZWKOTPCHSA-N |
| XLogP | 1.90 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|