C14H17N2O2+ — CID 7006688
[(2R)-3-(1H-indol-3-yl)-1-oxo-1-prop-2-enoxypropan-2-yl]azanium (PubChem CID 7006688) has the molecular formula C14H17N2O2+ and a molecular weight of 245.30 g/mol. Its IUPAC name is [(2R)-3-(1H-indol-3-yl)-1-oxo-1-prop-2-enoxypropan-2-yl]azanium.
| Compound Name | [(2R)-3-(1H-indol-3-yl)-1-oxo-1-prop-2-enoxypropan-2-yl]azanium |
|---|---|
| PubChem CID | 7006688 |
| Molecular Formula | C14H17N2O2+ |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | [(2R)-3-(1H-indol-3-yl)-1-oxo-1-prop-2-enoxypropan-2-yl]azanium |
| SMILES | C=CCOC(=O)[C@H]([NH3+])Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H16N2O2/c1-2-7-18-14(17)12(15)8-10-9-16-13-6-4-3-5-11(10)13/h2-6,9,12,16H,1,7-8,15H2/p+1/t12-/m1/s1 |
| InChIKey | SCHTYFMQEMJOJF-GFCCVEGCSA-O |
| XLogP | 1.05 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|