C24H31N3O2 — CID 132537903
tert-butyl N-[[(1S,6R)-6-(cyanomethyl)cyclohex-3-en-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 132537903) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is tert-butyl N-[[(1S,6R)-6-(cyanomethyl)cyclohex-3-en-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,6R)-6-(cyanomethyl)cyclohex-3-en-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 132537903 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | tert-butyl N-[[(1S,6R)-6-(cyanomethyl)cyclohex-3-en-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1c[nH]c2ccccc12)C[C@H]1CC=CC[C@@H]1CC#N |
| InChI | InChI=1S/C24H31N3O2/c1-24(2,3)29-23(28)27(17-20-9-5-4-8-18(20)12-14-25)15-13-19-16-26-22-11-7-6-10-21(19)22/h4-7,10-11,16,18,20,26H,8-9,12-13,15,17H2,1-3H3/t18-,20-/m1/s1 |
| InChIKey | HJSUUNGFZBQOGU-UYAOXDASSA-N |
| XLogP | 5.44 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|