C21H22FN3O2 — CID 108964965
N-(4-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108964965) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(4-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108964965 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NCCc1c[nH]c2ccccc12)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O2/c1-21(2,20(27)25-16-9-7-15(22)8-10-16)19(26)23-12-11-14-13-24-18-6-4-3-5-17(14)18/h3-10,13,24H,11-12H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | FJWUHUFNSLPCEN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|