C25H28N4O4 — CID 54529650
methyl 4-[[(1R)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobut-2-enoate (PubChem CID 54529650) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl 4-[[(1R)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[[(1R)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 54529650 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | methyl 4-[[(1R)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)C=CC(=O)N[C@@H](CNC(=O)[C@](C)(N)Cc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O4/c1-25(26,14-18-15-27-20-11-7-6-10-19(18)20)24(32)28-16-21(17-8-4-3-5-9-17)29-22(30)12-13-23(31)33-2/h3-13,15,21,27H,14,16,26H2,1-2H3,(H,28,32)(H,29,30)/t21-,25+/m0/s1 |
| InChIKey | YVPFMUCLOMREPQ-SQJMNOBHSA-N |
| XLogP | 2.13 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|