C36H45N5O6 — CID 15673182
2-adamantyl N-[(2R)-3-(1H-indol-3-yl)-1-[[(2R)-2-[[4-(methoxyamino)-4-oxobutanoyl]amino]-2-phenylethyl]amino]-2-methyl-1-oxopropan-2-yl]carbamate (PubChem CID 15673182) has the molecular formula C36H45N5O6 and a molecular weight of 643.79 g/mol. Its IUPAC name is 2-adamantyl N-[(2R)-3-(1H-indol-3-yl)-1-[[(2R)-2-[[4-(methoxyamino)-4-oxobutanoyl]amino]-2-phenylethyl]amino]-2-methyl-1-oxopropan-2-yl]carbamate.
| Compound Name | 2-adamantyl N-[(2R)-3-(1H-indol-3-yl)-1-[[(2R)-2-[[4-(methoxyamino)-4-oxobutanoyl]amino]-2-phenylethyl]amino]-2-methyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15673182 |
| Molecular Formula | C36H45N5O6 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.34 |
| IUPAC Name | 2-adamantyl N-[(2R)-3-(1H-indol-3-yl)-1-[[(2R)-2-[[4-(methoxyamino)-4-oxobutanoyl]amino]-2-phenylethyl]amino]-2-methyl-1-oxopropan-2-yl]carbamate |
| SMILES | CONC(=O)CCC(=O)N[C@@H](CNC(=O)[C@@](C)(Cc1c[nH]c2ccccc12)NC(=O)OC1C2CC3CC(C2)CC1C3)c1ccccc1 |
| InChI | InChI=1S/C36H45N5O6/c1-36(19-27-20-37-29-11-7-6-10-28(27)29,40-35(45)47-33-25-15-22-14-23(17-25)18-26(33)16-22)34(44)38-21-30(24-8-4-3-5-9-24)39-31(42)12-13-32(43)41-46-2/h3-11,20,22-23,25-26,30,33,37H,12-19,21H2,1-2H3,(H,38,44)(H,39,42)(H,40,45)(H,41,43)/t22?,23?,25?,26?,30-,33?,36+/m0/s1 |
| InChIKey | XRAQYXXVWRWJBR-SRMRTDOLSA-N |
| XLogP | 4.45 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|