C38H45N3O6 — CID 10722783
methyl 4-[[(1R)-2-[[2-(2-adamantyloxycarbonylamino)-2-methyl-3-naphthalen-1-ylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoate (PubChem CID 10722783) has the molecular formula C38H45N3O6 and a molecular weight of 639.79 g/mol. Its IUPAC name is methyl 4-[[(1R)-2-[[2-(2-adamantyloxycarbonylamino)-2-methyl-3-naphthalen-1-ylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[(1R)-2-[[2-(2-adamantyloxycarbonylamino)-2-methyl-3-naphthalen-1-ylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 10722783 |
| Molecular Formula | C38H45N3O6 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | methyl 4-[[(1R)-2-[[2-(2-adamantyloxycarbonylamino)-2-methyl-3-naphthalen-1-ylpropanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N[C@@H](CNC(=O)C(C)(Cc1cccc2ccccc12)NC(=O)OC1C2CC3CC(C2)CC1C3)c1ccccc1 |
| InChI | InChI=1S/C38H45N3O6/c1-38(22-28-13-8-12-26-9-6-7-14-31(26)28,41-37(45)47-35-29-18-24-17-25(20-29)21-30(35)19-24)36(44)39-23-32(27-10-4-3-5-11-27)40-33(42)15-16-34(43)46-2/h3-14,24-25,29-30,32,35H,15-23H2,1-2H3,(H,39,44)(H,40,42)(H,41,45)/t24?,25?,29?,30?,32-,35?,38?/m0/s1 |
| InChIKey | BJWVJFYRXIJOFD-OMHBRSDXSA-N |
| XLogP | 5.62 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |