C34H40N4O6 — CID 70693901
4-[[2-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoic acid (PubChem CID 70693901) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is 4-[[2-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70693901 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 4-[[2-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-1-phenylethyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(CNC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)OC1C2CC3CC(C2)CC1C3)c1ccccc1 |
| InChI | InChI=1S/C34H40N4O6/c39-30(10-11-31(40)41)37-29(22-6-2-1-3-7-22)19-36-33(42)28(17-25-18-35-27-9-5-4-8-26(25)27)38-34(43)44-32-23-13-20-12-21(15-23)16-24(32)14-20/h1-9,18,20-21,23-24,28-29,32,35H,10-17,19H2,(H,36,42)(H,37,39)(H,38,43)(H,40,41)/t20?,21?,23?,24?,28-,29?,32?/m1/s1 |
| InChIKey | XSFYBKCBNWVOCN-FHNBMSKRSA-N |
| XLogP | 4.47 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |