C21H29N3O3 — CID 175106415
prop-2-enyl 2-[[2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-4-methylpentanoate (PubChem CID 175106415) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is prop-2-enyl 2-[[2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | prop-2-enyl 2-[[2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 175106415 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | prop-2-enyl 2-[[2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-4-methylpentanoate |
| SMILES | C=CCOC(=O)C(CC(C)C)NC(=O)C(C)(N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H29N3O3/c1-5-10-27-19(25)18(11-14(2)3)24-20(26)21(4,22)12-15-13-23-17-9-7-6-8-16(15)17/h5-9,13-14,18,23H,1,10-12,22H2,2-4H3,(H,24,26) |
| InChIKey | GEJJNQYQTVFULW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|