C36H46N4O4 — CID 67820080
tert-butyl N-[(2S)-1-[[(2R)-1-(2-adamantylamino)-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 67820080) has the molecular formula C36H46N4O4 and a molecular weight of 598.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2R)-1-(2-adamantylamino)-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2R)-1-(2-adamantylamino)-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67820080 |
| Molecular Formula | C36H46N4O4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2R)-1-(2-adamantylamino)-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@](C)(Cc1c[nH]c2ccccc12)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C36H46N4O4/c1-35(2,3)44-34(43)38-30(19-22-10-6-5-7-11-22)32(41)40-36(4,20-27-21-37-29-13-9-8-12-28(27)29)33(42)39-31-25-15-23-14-24(17-25)18-26(31)16-23/h5-13,21,23-26,30-31,37H,14-20H2,1-4H3,(H,38,43)(H,39,42)(H,40,41)/t23?,24?,25?,26?,30-,31?,36+/m0/s1 |
| InChIKey | NNYLIMMFPHZAQS-SNRIYVPLSA-N |
| XLogP | 5.66 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |