C18H21NO5 — CID 135073532
dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(1H-indol-3-ylmethyl)propanedioate (PubChem CID 135073532) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(1H-indol-3-ylmethyl)propanedioate.
| Compound Name | dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(1H-indol-3-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 135073532 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(1H-indol-3-ylmethyl)propanedioate |
| SMILES | COC(=O)C(C/C=C\CO)(Cc1c[nH]c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C18H21NO5/c1-23-16(21)18(17(22)24-2,9-5-6-10-20)11-13-12-19-15-8-4-3-7-14(13)15/h3-8,12,19-20H,9-11H2,1-2H3/b6-5- |
| InChIKey | BUUKQTFUMUKLHD-WAYWQWQTSA-N |
| XLogP | 1.98 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|