C19H15F2NO4 — CID 177107817
acetyloxymethyl 2-[5-(3,5-difluorophenyl)-1H-indol-3-yl]acetate (PubChem CID 177107817) has the molecular formula C19H15F2NO4 and a molecular weight of 359.33 g/mol. Its IUPAC name is acetyloxymethyl 2-[5-(3,5-difluorophenyl)-1H-indol-3-yl]acetate.
| Compound Name | acetyloxymethyl 2-[5-(3,5-difluorophenyl)-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 177107817 |
| Molecular Formula | C19H15F2NO4 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | acetyloxymethyl 2-[5-(3,5-difluorophenyl)-1H-indol-3-yl]acetate |
| SMILES | CC(=O)OCOC(=O)Cc1c[nH]c2ccc(-c3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C19H15F2NO4/c1-11(23)25-10-26-19(24)7-14-9-22-18-3-2-12(6-17(14)18)13-4-15(20)8-16(21)5-13/h2-6,8-9,22H,7,10H2,1H3 |
| InChIKey | VNBFVZKQFZJLLV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|