C24H20F2N4O3 — CID 150924931
[2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluorophenyl)pyrazine-2-carbonyl]amino]methyl acetate (PubChem CID 150924931) has the molecular formula C24H20F2N4O3 and a molecular weight of 450.45 g/mol. Its IUPAC name is [2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluorophenyl)pyrazine-2-carbonyl]amino]methyl acetate.
| Compound Name | [2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluorophenyl)pyrazine-2-carbonyl]amino]methyl acetate |
|---|---|
| PubChem CID | 150924931 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluorophenyl)pyrazine-2-carbonyl]amino]methyl acetate |
| SMILES | CC(=O)OCN(CCc1c[nH]c2ccc(F)cc12)C(=O)c1nccnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20F2N4O3/c1-15(31)33-14-30(11-8-17-13-29-21-7-6-19(26)12-20(17)21)24(32)23-22(27-9-10-28-23)16-2-4-18(25)5-3-16/h2-7,9-10,12-13,29H,8,11,14H2,1H3 |
| InChIKey | LEVCPBPYMUUQNL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|