C25H22F2N4O3 — CID 152561012
[2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluoro-3-methylphenyl)pyrazine-2-carbonyl]amino]methyl acetate (PubChem CID 152561012) has the molecular formula C25H22F2N4O3 and a molecular weight of 464.47 g/mol. Its IUPAC name is [2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluoro-3-methylphenyl)pyrazine-2-carbonyl]amino]methyl acetate.
| Compound Name | [2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluoro-3-methylphenyl)pyrazine-2-carbonyl]amino]methyl acetate |
|---|---|
| PubChem CID | 152561012 |
| Molecular Formula | C25H22F2N4O3 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [2-(5-fluoro-1H-indol-3-yl)ethyl-[3-(4-fluoro-3-methylphenyl)pyrazine-2-carbonyl]amino]methyl acetate |
| SMILES | CC(=O)OCN(CCc1c[nH]c2ccc(F)cc12)C(=O)c1nccnc1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C25H22F2N4O3/c1-15-11-17(3-5-21(15)27)23-24(29-9-8-28-23)25(33)31(14-34-16(2)32)10-7-18-13-30-22-6-4-19(26)12-20(18)22/h3-6,8-9,11-13,30H,7,10,14H2,1-2H3 |
| InChIKey | YPMNZTSNIKRYQF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|